C22H25BrN4O2 — CID 46950179
5-bromo-6-methoxy-3-[[4-(4-methylpiperazin-1-yl)anilino]methyl]-1H-quinolin-2-one (PubChem CID 46950179) has the molecular formula C22H25BrN4O2 and a molecular weight of 457.37 g/mol. Its IUPAC name is 5-bromo-6-methoxy-3-[[4-(4-methylpiperazin-1-yl)anilino]methyl]-1H-quinolin-2-one.
| Compound Name | 5-bromo-6-methoxy-3-[[4-(4-methylpiperazin-1-yl)anilino]methyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 46950179 |
| Molecular Formula | C22H25BrN4O2 |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 5-bromo-6-methoxy-3-[[4-(4-methylpiperazin-1-yl)anilino]methyl]-1H-quinolin-2-one |
| SMILES | COc1ccc2[nH]c(=O)c(CNc3ccc(N4CCN(C)CC4)cc3)cc2c1Br |
| InChI | InChI=1S/C22H25BrN4O2/c1-26-9-11-27(12-10-26)17-5-3-16(4-6-17)24-14-15-13-18-19(25-22(15)28)7-8-20(29-2)21(18)23/h3-8,13,24H,9-12,14H2,1-2H3,(H,25,28) |
| InChIKey | VMBHXBZMHHBVMD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|