C22H19ClFN5 — CID 46951024
4-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-(1-methylimidazol-2-yl)pyrimidin-2-amine (PubChem CID 46951024) has the molecular formula C22H19ClFN5 and a molecular weight of 407.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-(1-methylimidazol-2-yl)pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-(1-methylimidazol-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 46951024 |
| Molecular Formula | C22H19ClFN5 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-5-(1-methylimidazol-2-yl)pyrimidin-2-amine |
| SMILES | Cn1ccnc1-c1cnc(NCCc2ccc(F)cc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClFN5/c1-29-13-12-25-21(29)19-14-27-22(26-11-10-15-2-8-18(24)9-3-15)28-20(19)16-4-6-17(23)7-5-16/h2-9,12-14H,10-11H2,1H3,(H,26,27,28) |
| InChIKey | XVIZCTDQRVVWGB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |