C19H17ClFN3 — CID 171989077
5-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine (PubChem CID 171989077) has the molecular formula C19H17ClFN3 and a molecular weight of 341.82 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine.
| Compound Name | 5-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 171989077 |
| Molecular Formula | C19H17ClFN3 |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[2-(4-fluorophenyl)ethyl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1nc(NCCc2ccc(F)cc2)ncc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17ClFN3/c1-13-18(15-4-6-16(20)7-5-15)12-23-19(24-13)22-11-10-14-2-8-17(21)9-3-14/h2-9,12H,10-11H2,1H3,(H,22,23,24) |
| InChIKey | SDVILSHDABDXES-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |