C26H34N2O2 — CID 46951727
4-(3,5-dimethylphenyl)-N-[(4-piperidin-1-ylphenyl)methyl]oxane-4-carboxamide (PubChem CID 46951727) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-N-[(4-piperidin-1-ylphenyl)methyl]oxane-4-carboxamide.
| Compound Name | 4-(3,5-dimethylphenyl)-N-[(4-piperidin-1-ylphenyl)methyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 46951727 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-N-[(4-piperidin-1-ylphenyl)methyl]oxane-4-carboxamide |
| SMILES | Cc1cc(C)cc(C2(C(=O)NCc3ccc(N4CCCCC4)cc3)CCOCC2)c1 |
| InChI | InChI=1S/C26H34N2O2/c1-20-16-21(2)18-23(17-20)26(10-14-30-15-11-26)25(29)27-19-22-6-8-24(9-7-22)28-12-4-3-5-13-28/h6-9,16-18H,3-5,10-15,19H2,1-2H3,(H,27,29) |
| InChIKey | XAAFLSVTNSUTFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|