C20H28N4O — CID 46953029
(3R,7R)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 46953029) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (3R,7R)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3R,7R)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 46953029 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (3R,7R)-2-[(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | Cc1cc(CN2CC3C[C@@H](O)CN3C[C@H]2C)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C20H28N4O/c1-14-8-17(16(3)24(14)20-6-4-5-7-21-20)11-22-12-18-9-19(25)13-23(18)10-15(22)2/h4-8,15,18-19,25H,9-13H2,1-3H3/t15-,18?,19-/m1/s1 |
| InChIKey | PPWHSKGSNNVHRE-QYHYLKRQSA-N |
| XLogP | 2.13 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|