C22H28N2O2 — CID 46953969
2-[[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-5-methoxyphenol (PubChem CID 46953969) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-[[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-5-methoxyphenol.
| Compound Name | 2-[[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 46953969 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[[(3S,8aS)-3-benzyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]methyl]-5-methoxyphenol |
| SMILES | COc1ccc(CN2C[C@@H]3CCCN3C[C@@H]2Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-26-21-10-9-18(22(25)13-21)14-24-15-19-8-5-11-23(19)16-20(24)12-17-6-3-2-4-7-17/h2-4,6-7,9-10,13,19-20,25H,5,8,11-12,14-16H2,1H3/t19-,20-/m0/s1 |
| InChIKey | FQWHICRTWZHSGI-PMACEKPBSA-N |
| XLogP | 3.29 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|