C24H32N2O3 — CID 16677876
(3S,8aS)-3-benzyl-2-[(3,4,5-trimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 16677876) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is (3S,8aS)-3-benzyl-2-[(3,4,5-trimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3S,8aS)-3-benzyl-2-[(3,4,5-trimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 16677876 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | (3S,8aS)-3-benzyl-2-[(3,4,5-trimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1cc(CN2C[C@@H]3CCCN3C[C@@H]2Cc2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H32N2O3/c1-27-22-13-19(14-23(28-2)24(22)29-3)15-26-16-20-10-7-11-25(20)17-21(26)12-18-8-5-4-6-9-18/h4-6,8-9,13-14,20-21H,7,10-12,15-17H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | SLROMJHAJNOPMM-SFTDATJTSA-N |
| XLogP | 3.60 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |