C20H28N4O2 — CID 46954677
[2,2-bis(prop-2-enyl)azetidin-1-yl]-(4-ethyl-2-morpholin-4-ylpyrimidin-5-yl)methanone (PubChem CID 46954677) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is [2,2-bis(prop-2-enyl)azetidin-1-yl]-(4-ethyl-2-morpholin-4-ylpyrimidin-5-yl)methanone.
| Compound Name | [2,2-bis(prop-2-enyl)azetidin-1-yl]-(4-ethyl-2-morpholin-4-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 46954677 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | [2,2-bis(prop-2-enyl)azetidin-1-yl]-(4-ethyl-2-morpholin-4-ylpyrimidin-5-yl)methanone |
| SMILES | C=CCC1(CC=C)CCN1C(=O)c1cnc(N2CCOCC2)nc1CC |
| InChI | InChI=1S/C20H28N4O2/c1-4-7-20(8-5-2)9-10-24(20)18(25)16-15-21-19(22-17(16)6-3)23-11-13-26-14-12-23/h4-5,15H,1-2,6-14H2,3H3 |
| InChIKey | HJJZXURXTOEIGJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|