C16H17N3O2S — CID 46955814
N-(2-methoxyethyl)-2-(7-thiophen-2-ylpyrrolo[2,3-c]pyridin-1-yl)acetamide (PubChem CID 46955814) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(7-thiophen-2-ylpyrrolo[2,3-c]pyridin-1-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(7-thiophen-2-ylpyrrolo[2,3-c]pyridin-1-yl)acetamide |
|---|---|
| PubChem CID | 46955814 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-(2-methoxyethyl)-2-(7-thiophen-2-ylpyrrolo[2,3-c]pyridin-1-yl)acetamide |
| SMILES | COCCNC(=O)Cn1ccc2ccnc(-c3cccs3)c21 |
| InChI | InChI=1S/C16H17N3O2S/c1-21-9-7-17-14(20)11-19-8-5-12-4-6-18-15(16(12)19)13-3-2-10-22-13/h2-6,8,10H,7,9,11H2,1H3,(H,17,20) |
| InChIKey | GZRJLXUZKVQRSP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|