C17H17FN2O2S — CID 53032532
2-(5-fluoro-2-thiophen-2-ylindol-1-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 53032532) has the molecular formula C17H17FN2O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-(5-fluoro-2-thiophen-2-ylindol-1-yl)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(5-fluoro-2-thiophen-2-ylindol-1-yl)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 53032532 |
| Molecular Formula | C17H17FN2O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(5-fluoro-2-thiophen-2-ylindol-1-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1c(-c2cccs2)cc2cc(F)ccc21 |
| InChI | InChI=1S/C17H17FN2O2S/c1-22-7-6-19-17(21)11-20-14-5-4-13(18)9-12(14)10-15(20)16-3-2-8-23-16/h2-5,8-10H,6-7,11H2,1H3,(H,19,21) |
| InChIKey | OULVBKRMKAGGIX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|