C19H22N2OS — CID 20907262
N-(3-methylbutyl)-2-(2-thiophen-2-ylindol-1-yl)acetamide (PubChem CID 20907262) has the molecular formula C19H22N2OS and a molecular weight of 326.46 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-(2-thiophen-2-ylindol-1-yl)acetamide.
| Compound Name | N-(3-methylbutyl)-2-(2-thiophen-2-ylindol-1-yl)acetamide |
|---|---|
| PubChem CID | 20907262 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-(3-methylbutyl)-2-(2-thiophen-2-ylindol-1-yl)acetamide |
| SMILES | CC(C)CCNC(=O)Cn1c(-c2cccs2)cc2ccccc21 |
| InChI | InChI=1S/C19H22N2OS/c1-14(2)9-10-20-19(22)13-21-16-7-4-3-6-15(16)12-17(21)18-8-5-11-23-18/h3-8,11-12,14H,9-10,13H2,1-2H3,(H,20,22) |
| InChIKey | WNLQEOYIQNESSG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |