C22H31N3O4 — CID 46956499
1-[(4aS,7aS)-1-(2-ethoxypyridine-3-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-(oxolan-2-yl)propan-1-one (PubChem CID 46956499) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-[(4aS,7aS)-1-(2-ethoxypyridine-3-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-(oxolan-2-yl)propan-1-one.
| Compound Name | 1-[(4aS,7aS)-1-(2-ethoxypyridine-3-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-(oxolan-2-yl)propan-1-one |
|---|---|
| PubChem CID | 46956499 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-[(4aS,7aS)-1-(2-ethoxypyridine-3-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-(oxolan-2-yl)propan-1-one |
| SMILES | CCOc1ncccc1C(=O)N1CCC[C@H]2CN(C(=O)CCC3CCCO3)C[C@H]21 |
| InChI | InChI=1S/C22H31N3O4/c1-2-28-21-18(8-3-11-23-21)22(27)25-12-4-6-16-14-24(15-19(16)25)20(26)10-9-17-7-5-13-29-17/h3,8,11,16-17,19H,2,4-7,9-10,12-15H2,1H3/t16-,17?,19+/m0/s1 |
| InChIKey | NRSFBIIPPBFSBM-LVLJQFTKSA-N |
| XLogP | 2.50 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |