C18H23N3O3S — CID 24899183
N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]-2-ethoxypyridine-3-carboxamide (PubChem CID 24899183) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]-2-ethoxypyridine-3-carboxamide.
| Compound Name | N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]-2-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 24899183 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]-2-ethoxypyridine-3-carboxamide |
| SMILES | CCOc1ncccc1C(=O)/N=c1\sc(C)c(C)n1CC1CCCO1 |
| InChI | InChI=1S/C18H23N3O3S/c1-4-23-17-15(8-5-9-19-17)16(22)20-18-21(12(2)13(3)25-18)11-14-7-6-10-24-14/h5,8-9,14H,4,6-7,10-11H2,1-3H3/b20-18- |
| InChIKey | WELGVCNTCNOVIR-ZZEZOPTASA-N |
| XLogP | 2.88 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|