C20H19Cl2N3O2S — CID 68623217
5,6-dichloro-N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]quinoline-8-carboxamide (PubChem CID 68623217) has the molecular formula C20H19Cl2N3O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is 5,6-dichloro-N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]quinoline-8-carboxamide.
| Compound Name | 5,6-dichloro-N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 68623217 |
| Molecular Formula | C20H19Cl2N3O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 5,6-dichloro-N-[4,5-dimethyl-3-(oxolan-2-ylmethyl)-1,3-thiazol-2-ylidene]quinoline-8-carboxamide |
| SMILES | Cc1s/c(=N\C(=O)c2cc(Cl)c(Cl)c3cccnc23)n(CC2CCCO2)c1C |
| InChI | InChI=1S/C20H19Cl2N3O2S/c1-11-12(2)28-20(25(11)10-13-5-4-8-27-13)24-19(26)15-9-16(21)17(22)14-6-3-7-23-18(14)15/h3,6-7,9,13H,4-5,8,10H2,1-2H3/b24-20- |
| InChIKey | BIPOSGRLOMLJHB-GFMRDNFCSA-N |
| XLogP | 4.94 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|