C26H29N5O — CID 46958545
6-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrimidin-4-amine (PubChem CID 46958545) has the molecular formula C26H29N5O and a molecular weight of 427.55 g/mol. Its IUPAC name is 6-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrimidin-4-amine.
| Compound Name | 6-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46958545 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 6-[2-(1H-benzimidazol-2-yl)ethyl]-2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1nc(CCc2nc3ccccc3[nH]2)cc(NCC2(c3ccccc3)CCOCC2)n1 |
| InChI | InChI=1S/C26H29N5O/c1-19-28-21(11-12-24-30-22-9-5-6-10-23(22)31-24)17-25(29-19)27-18-26(13-15-32-16-14-26)20-7-3-2-4-8-20/h2-10,17H,11-16,18H2,1H3,(H,30,31)(H,27,28,29) |
| InChIKey | SEXGNCJLQWPWMK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |