C15H22F2N2O2 — CID 46960615
(3R,4R)-1-[(3,4-difluorophenyl)methyl]-4-(2-methoxyethylamino)piperidin-3-ol (PubChem CID 46960615) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3R,4R)-1-[(3,4-difluorophenyl)methyl]-4-(2-methoxyethylamino)piperidin-3-ol.
| Compound Name | (3R,4R)-1-[(3,4-difluorophenyl)methyl]-4-(2-methoxyethylamino)piperidin-3-ol |
|---|---|
| PubChem CID | 46960615 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (3R,4R)-1-[(3,4-difluorophenyl)methyl]-4-(2-methoxyethylamino)piperidin-3-ol |
| SMILES | COCCN[C@@H]1CCN(Cc2ccc(F)c(F)c2)C[C@H]1O |
| InChI | InChI=1S/C15H22F2N2O2/c1-21-7-5-18-14-4-6-19(10-15(14)20)9-11-2-3-12(16)13(17)8-11/h2-3,8,14-15,18,20H,4-7,9-10H2,1H3/t14-,15-/m1/s1 |
| InChIKey | AOCRKPSVXJRLTN-HUUCEWRRSA-N |
| XLogP | 1.14 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|