C20H21N3O2 — CID 46964091
5-methyl-3-(3-methylphenyl)-N-(3-pyridin-2-ylpropyl)-1,2-oxazole-4-carboxamide (PubChem CID 46964091) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-methyl-3-(3-methylphenyl)-N-(3-pyridin-2-ylpropyl)-1,2-oxazole-4-carboxamide.
| Compound Name | 5-methyl-3-(3-methylphenyl)-N-(3-pyridin-2-ylpropyl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46964091 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-methyl-3-(3-methylphenyl)-N-(3-pyridin-2-ylpropyl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cccc(-c2noc(C)c2C(=O)NCCCc2ccccn2)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-14-7-5-8-16(13-14)19-18(15(2)25-23-19)20(24)22-12-6-10-17-9-3-4-11-21-17/h3-5,7-9,11,13H,6,10,12H2,1-2H3,(H,22,24) |
| InChIKey | YZOBSADQERVICT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|