C16H16N6OS — CID 46967760
[2-[(5-pyridin-4-yltetrazol-2-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 46967760) has the molecular formula C16H16N6OS and a molecular weight of 340.41 g/mol. Its IUPAC name is [2-[(5-pyridin-4-yltetrazol-2-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [2-[(5-pyridin-4-yltetrazol-2-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 46967760 |
| Molecular Formula | C16H16N6OS |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [2-[(5-pyridin-4-yltetrazol-2-yl)methyl]pyrrolidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCCC1Cn1nnc(-c2ccncc2)n1 |
| InChI | InChI=1S/C16H16N6OS/c23-16(14-4-2-10-24-14)21-9-1-3-13(21)11-22-19-15(18-20-22)12-5-7-17-8-6-12/h2,4-8,10,13H,1,3,9,11H2 |
| InChIKey | VXVKHKUHPOKAPU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |