C20H29N3O5S — CID 46969271
1-[2-[4-[2-(2,3-dimethylphenoxy)ethyl]piperazin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione (PubChem CID 46969271) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 1-[2-[4-[2-(2,3-dimethylphenoxy)ethyl]piperazin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-[2-(2,3-dimethylphenoxy)ethyl]piperazin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 46969271 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[2-[4-[2-(2,3-dimethylphenoxy)ethyl]piperazin-1-yl]sulfonylethyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cccc(OCCN2CCN(S(=O)(=O)CCN3C(=O)CCC3=O)CC2)c1C |
| InChI | InChI=1S/C20H29N3O5S/c1-16-4-3-5-18(17(16)2)28-14-12-21-8-10-22(11-9-21)29(26,27)15-13-23-19(24)6-7-20(23)25/h3-5H,6-15H2,1-2H3 |
| InChIKey | GYRUQPFCAGEIAL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|