C15H17F3N6O2 — CID 46970101
N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)propanamide (PubChem CID 46970101) has the molecular formula C15H17F3N6O2 and a molecular weight of 370.34 g/mol. Its IUPAC name is N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)propanamide.
| Compound Name | N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 46970101 |
| Molecular Formula | C15H17F3N6O2 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-[4-morpholin-4-yl-3-(trifluoromethyl)phenyl]-3-(tetrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cnnn1)Nc1ccc(N2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N6O2/c16-15(17,18)12-9-11(1-2-13(12)23-5-7-26-8-6-23)20-14(25)3-4-24-10-19-21-22-24/h1-2,9-10H,3-8H2,(H,20,25) |
| InChIKey | YEDOGZMYLHSPHW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|