C19H16F3N3O — CID 168520250
2-cyano-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 168520250) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-cyano-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 168520250 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-cyano-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H16F3N3O/c20-19(21,22)16-11-15(24-18(26)7-9-23)5-6-17(16)25-10-8-13-3-1-2-4-14(13)12-25/h1-6,11H,7-8,10,12H2,(H,24,26) |
| InChIKey | WOCLXVIPRBWVHS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|