C16H13F3N4 — CID 169324790
2-[4-azido-2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 169324790) has the molecular formula C16H13F3N4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-[4-azido-2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-[4-azido-2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 169324790 |
| Molecular Formula | C16H13F3N4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-[4-azido-2-(trifluoromethyl)phenyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | [N-]=[N+]=Nc1ccc(N2CCc3ccccc3C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N4/c17-16(18,19)14-9-13(21-22-20)5-6-15(14)23-8-7-11-3-1-2-4-12(11)10-23/h1-6,9H,7-8,10H2 |
| InChIKey | LXRUJXOWJGLXKQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|