C20H22N4O3S — CID 46971928
N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide (PubChem CID 46971928) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide.
| Compound Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 46971928 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-1,3-dimethyl-2-oxobenzimidazole-5-sulfonamide |
| SMILES | Cc1[nH]c2ccc(CNS(=O)(=O)c3ccc4c(c3)n(C)c(=O)n4C)cc2c1C |
| InChI | InChI=1S/C20H22N4O3S/c1-12-13(2)22-17-7-5-14(9-16(12)17)11-21-28(26,27)15-6-8-18-19(10-15)24(4)20(25)23(18)3/h5-10,21-22H,11H2,1-4H3 |
| InChIKey | URXKBGNRYYUHJZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|