C17H25N3O3S — CID 52527539
(2S,6S)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2,6-dimethylmorpholine-4-sulfonamide (PubChem CID 52527539) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is (2S,6S)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2,6-dimethylmorpholine-4-sulfonamide.
| Compound Name | (2S,6S)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2,6-dimethylmorpholine-4-sulfonamide |
|---|---|
| PubChem CID | 52527539 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (2S,6S)-N-[(2,3-dimethyl-1H-indol-5-yl)methyl]-2,6-dimethylmorpholine-4-sulfonamide |
| SMILES | Cc1[nH]c2ccc(CNS(=O)(=O)N3C[C@H](C)O[C@@H](C)C3)cc2c1C |
| InChI | InChI=1S/C17H25N3O3S/c1-11-9-20(10-12(2)23-11)24(21,22)18-8-15-5-6-17-16(7-15)13(3)14(4)19-17/h5-7,11-12,18-19H,8-10H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | RQDNUEWWJJRLMC-RYUDHWBXSA-N |
| XLogP | 2.23 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|