C20H25ClN2O2 — CID 46972616
[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methanone (PubChem CID 46972616) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.89 g/mol. Its IUPAC name is [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methanone.
| Compound Name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46972616 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methanone |
| SMILES | O=C([C@@H]1C[C@@H]2C=C[C@H]1C2)N1CCN(CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H25ClN2O2/c21-17-3-5-18(6-4-17)25-12-11-22-7-9-23(10-8-22)20(24)19-14-15-1-2-16(19)13-15/h1-6,15-16,19H,7-14H2/t15-,16+,19-/m1/s1 |
| InChIKey | VCFRMKQRMVNVQR-JTDSTZFVSA-N |
| XLogP | 3.08 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|