C21H24ClN3O4 — CID 46972949
N-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 46972949) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is N-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 46972949 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-2-(6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CC(NC(=O)CN1C(=O)NC2(CCCCC2C)C1=O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-12-5-3-4-8-21(12)19(27)25(20(28)24-21)11-18(26)23-13(2)17-10-14-9-15(22)6-7-16(14)29-17/h6-7,9-10,12-13H,3-5,8,11H2,1-2H3,(H,23,26)(H,24,28) |
| InChIKey | VOWPDWFRURXNGE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|