C21H24N4O3 — CID 46976122
N-[2-[2-(dimethylamino)ethoxy]-5-methylphenyl]-4-methyl-3-oxoquinoxaline-2-carboxamide (PubChem CID 46976122) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]-5-methylphenyl]-4-methyl-3-oxoquinoxaline-2-carboxamide.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]-5-methylphenyl]-4-methyl-3-oxoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 46976122 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]-5-methylphenyl]-4-methyl-3-oxoquinoxaline-2-carboxamide |
| SMILES | Cc1ccc(OCCN(C)C)c(NC(=O)c2nc3ccccc3n(C)c2=O)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-9-10-18(28-12-11-24(2)3)16(13-14)23-20(26)19-21(27)25(4)17-8-6-5-7-15(17)22-19/h5-10,13H,11-12H2,1-4H3,(H,23,26) |
| InChIKey | BDBLUUCWTSBAMY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |