C16H23N5O4 — CID 46982056
methyl 2-[1-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 46982056) has the molecular formula C16H23N5O4 and a molecular weight of 349.39 g/mol. Its IUPAC name is methyl 2-[1-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | methyl 2-[1-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 46982056 |
| Molecular Formula | C16H23N5O4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | methyl 2-[1-[(2-morpholin-4-ylpyrimidin-5-yl)methyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COC(=O)CC1C(=O)NCCN1Cc1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C16H23N5O4/c1-24-14(22)8-13-15(23)17-2-3-21(13)11-12-9-18-16(19-10-12)20-4-6-25-7-5-20/h9-10,13H,2-8,11H2,1H3,(H,17,23) |
| InChIKey | WSSIYJVUOLFYKS-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |