C16H23N5O3 — CID 51872386
methyl 2-[(2R)-3-oxo-1-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]piperazin-2-yl]acetate (PubChem CID 51872386) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is methyl 2-[(2R)-3-oxo-1-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]piperazin-2-yl]acetate.
| Compound Name | methyl 2-[(2R)-3-oxo-1-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 51872386 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | methyl 2-[(2R)-3-oxo-1-[(2-pyrrolidin-1-ylpyrimidin-4-yl)methyl]piperazin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C(=O)NCCN1Cc1ccnc(N2CCCC2)n1 |
| InChI | InChI=1S/C16H23N5O3/c1-24-14(22)10-13-15(23)17-6-9-21(13)11-12-4-5-18-16(19-12)20-7-2-3-8-20/h4-5,13H,2-3,6-11H2,1H3,(H,17,23)/t13-/m1/s1 |
| InChIKey | VBMYLZMTLCTXBZ-CYBMUJFWSA-N |
| XLogP | -0.06 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |