C15H26N4O2S — CID 46982538
(1R,9aR)-1-[[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46982538) has the molecular formula C15H26N4O2S and a molecular weight of 326.47 g/mol. Its IUPAC name is (1R,9aR)-1-[[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46982538 |
| Molecular Formula | C15H26N4O2S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (1R,9aR)-1-[[[3-(methylsulfanylmethyl)-1,2,4-oxadiazol-5-yl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | CSCc1noc(CNC[C@]2(O)CCCN3CCCC[C@@H]32)n1 |
| InChI | InChI=1S/C15H26N4O2S/c1-22-10-13-17-14(21-18-13)9-16-11-15(20)6-4-8-19-7-3-2-5-12(15)19/h12,16,20H,2-11H2,1H3/t12-,15-/m1/s1 |
| InChIKey | VJTBWZFUYLWVCE-IUODEOHRSA-N |
| XLogP | 1.40 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |