C15H16F3NO5 — CID 46982763
4,4,4-trifluoro-3-[[2-(4-propanoylphenoxy)acetyl]amino]butanoic acid (PubChem CID 46982763) has the molecular formula C15H16F3NO5 and a molecular weight of 347.29 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[[2-(4-propanoylphenoxy)acetyl]amino]butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-[[2-(4-propanoylphenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 46982763 |
| Molecular Formula | C15H16F3NO5 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4,4,4-trifluoro-3-[[2-(4-propanoylphenoxy)acetyl]amino]butanoic acid |
| SMILES | CCC(=O)c1ccc(OCC(=O)NC(CC(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H16F3NO5/c1-2-11(20)9-3-5-10(6-4-9)24-8-13(21)19-12(7-14(22)23)15(16,17)18/h3-6,12H,2,7-8H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | MWROAMHANOCENC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |