C21H30N4O — CID 46983982
(1R,9aR)-1-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol (PubChem CID 46983982) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is (1R,9aR)-1-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol.
| Compound Name | (1R,9aR)-1-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
|---|---|
| PubChem CID | 46983982 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | (1R,9aR)-1-[[[2-(2-methylimidazol-1-yl)phenyl]methylamino]methyl]-2,3,4,6,7,8,9,9a-octahydroquinolizin-1-ol |
| SMILES | Cc1nccn1-c1ccccc1CNC[C@]1(O)CCCN2CCCC[C@@H]21 |
| InChI | InChI=1S/C21H30N4O/c1-17-23-11-14-25(17)19-8-3-2-7-18(19)15-22-16-21(26)10-6-13-24-12-5-4-9-20(21)24/h2-3,7-8,11,14,20,22,26H,4-6,9-10,12-13,15-16H2,1H3/t20-,21-/m1/s1 |
| InChIKey | FYAQTWPRVOSODZ-NHCUHLMSSA-N |
| XLogP | 2.65 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |