C20H24N4O — CID 46987148
3-[3-[(3-pyridin-4-ylpropylamino)methyl]indol-1-yl]propanamide (PubChem CID 46987148) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[3-[(3-pyridin-4-ylpropylamino)methyl]indol-1-yl]propanamide.
| Compound Name | 3-[3-[(3-pyridin-4-ylpropylamino)methyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 46987148 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3-[3-[(3-pyridin-4-ylpropylamino)methyl]indol-1-yl]propanamide |
| SMILES | NC(=O)CCn1cc(CNCCCc2ccncc2)c2ccccc21 |
| InChI | InChI=1S/C20H24N4O/c21-20(25)9-13-24-15-17(18-5-1-2-6-19(18)24)14-23-10-3-4-16-7-11-22-12-8-16/h1-2,5-8,11-12,15,23H,3-4,9-10,13-14H2,(H2,21,25) |
| InChIKey | VPNIPGWVBPECAO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|