C20H21N5OS — CID 46983716
3-[3-[[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]methyl]indol-1-yl]propanamide (PubChem CID 46983716) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 3-[3-[[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]methyl]indol-1-yl]propanamide.
| Compound Name | 3-[3-[[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]methyl]indol-1-yl]propanamide |
|---|---|
| PubChem CID | 46983716 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 3-[3-[[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]methyl]indol-1-yl]propanamide |
| SMILES | NC(=O)CCn1cc(CNCc2cn[nH]c2-c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C20H21N5OS/c21-19(26)7-8-25-13-15(16-4-1-2-5-17(16)25)11-22-10-14-12-23-24-20(14)18-6-3-9-27-18/h1-6,9,12-13,22H,7-8,10-11H2,(H2,21,26)(H,23,24) |
| InChIKey | BFOUVBTYIPPSTA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |