C13H14N6OS — CID 43783591
2-[4-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]pyrazol-1-yl]acetamide (PubChem CID 43783591) has the molecular formula C13H14N6OS and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-[4-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 43783591 |
| Molecular Formula | C13H14N6OS |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[4-[(5-thiophen-2-yl-1H-pyrazol-4-yl)methylamino]pyrazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(NCc2cn[nH]c2-c2cccs2)cn1 |
| InChI | InChI=1S/C13H14N6OS/c14-12(20)8-19-7-10(6-17-19)15-4-9-5-16-18-13(9)11-2-1-3-21-11/h1-3,5-7,15H,4,8H2,(H2,14,20)(H,16,18) |
| InChIKey | PMUXUFGYGQJDIO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |