C11H14N6O3 — CID 46988642
methyl 1-[2-[(2-ethyltriazol-4-yl)amino]-2-oxoethyl]pyrazole-3-carboxylate (PubChem CID 46988642) has the molecular formula C11H14N6O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is methyl 1-[2-[(2-ethyltriazol-4-yl)amino]-2-oxoethyl]pyrazole-3-carboxylate.
| Compound Name | methyl 1-[2-[(2-ethyltriazol-4-yl)amino]-2-oxoethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46988642 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | methyl 1-[2-[(2-ethyltriazol-4-yl)amino]-2-oxoethyl]pyrazole-3-carboxylate |
| SMILES | CCn1ncc(NC(=O)Cn2ccc(C(=O)OC)n2)n1 |
| InChI | InChI=1S/C11H14N6O3/c1-3-17-12-6-9(15-17)13-10(18)7-16-5-4-8(14-16)11(19)20-2/h4-6H,3,7H2,1-2H3,(H,13,15,18) |
| InChIKey | ICQFDUJYCUFTQE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |