C24H29N3 — CID 46988681
1-[1-[3-(2-methylphenyl)phenyl]piperidin-4-yl]piperidine-4-carbonitrile (PubChem CID 46988681) has the molecular formula C24H29N3 and a molecular weight of 359.52 g/mol. Its IUPAC name is 1-[1-[3-(2-methylphenyl)phenyl]piperidin-4-yl]piperidine-4-carbonitrile.
| Compound Name | 1-[1-[3-(2-methylphenyl)phenyl]piperidin-4-yl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 46988681 |
| Molecular Formula | C24H29N3 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 1-[1-[3-(2-methylphenyl)phenyl]piperidin-4-yl]piperidine-4-carbonitrile |
| SMILES | Cc1ccccc1-c1cccc(N2CCC(N3CCC(C#N)CC3)CC2)c1 |
| InChI | InChI=1S/C24H29N3/c1-19-5-2-3-8-24(19)21-6-4-7-23(17-21)27-15-11-22(12-16-27)26-13-9-20(18-25)10-14-26/h2-8,17,20,22H,9-16H2,1H3 |
| InChIKey | MTLBONKFCDQPHW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |