C17H21N3OS2 — CID 46993181
2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(thiophen-3-ylmethyl)amino]butan-1-ol (PubChem CID 46993181) has the molecular formula C17H21N3OS2 and a molecular weight of 347.51 g/mol. Its IUPAC name is 2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(thiophen-3-ylmethyl)amino]butan-1-ol.
| Compound Name | 2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(thiophen-3-ylmethyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 46993181 |
| Molecular Formula | C17H21N3OS2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(thiophen-3-ylmethyl)amino]butan-1-ol |
| SMILES | CCC(CO)N(Cc1ccsc1)Cc1ccc(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C17H21N3OS2/c1-2-14(11-21)20(9-13-6-8-22-12-13)10-15-3-4-17(23-15)16-5-7-18-19-16/h3-8,12,14,21H,2,9-11H2,1H3,(H,18,19) |
| InChIKey | KVMJVHLNTIQSBP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |