C18H21N3OS2 — CID 46994934
2-[(4-methylsulfanylphenyl)methyl-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]amino]ethanol (PubChem CID 46994934) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-[(4-methylsulfanylphenyl)methyl-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]amino]ethanol.
| Compound Name | 2-[(4-methylsulfanylphenyl)methyl-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 46994934 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-[(4-methylsulfanylphenyl)methyl-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]amino]ethanol |
| SMILES | CSc1ccc(CN(CCO)Cc2ccc(-c3ccn[nH]3)s2)cc1 |
| InChI | InChI=1S/C18H21N3OS2/c1-23-15-4-2-14(3-5-15)12-21(10-11-22)13-16-6-7-18(24-16)17-8-9-19-20-17/h2-9,22H,10-13H2,1H3,(H,19,20) |
| InChIKey | MXXZJGRVPWNHNG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |