C18H22N4OS — CID 46996775
2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(pyridin-3-ylmethyl)amino]butan-1-ol (PubChem CID 46996775) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is 2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(pyridin-3-ylmethyl)amino]butan-1-ol.
| Compound Name | 2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(pyridin-3-ylmethyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 46996775 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl-(pyridin-3-ylmethyl)amino]butan-1-ol |
| SMILES | CCC(CO)N(Cc1cccnc1)Cc1ccc(-c2ccn[nH]2)s1 |
| InChI | InChI=1S/C18H22N4OS/c1-2-15(13-23)22(11-14-4-3-8-19-10-14)12-16-5-6-18(24-16)17-7-9-20-21-17/h3-10,15,23H,2,11-13H2,1H3,(H,20,21) |
| InChIKey | POSHBYJHIAQKNX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |