C19H21N5OS — CID 46994178
4-[4-(4-methyl-7-methylsulfanylquinolin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 46994178) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 4-[4-(4-methyl-7-methylsulfanylquinolin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 4-[4-(4-methyl-7-methylsulfanylquinolin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 46994178 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-[4-(4-methyl-7-methylsulfanylquinolin-2-yl)piperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | CSc1ccc2c(C)cc(N3CCN(c4cn[nH]c(=O)c4)CC3)nc2c1 |
| InChI | InChI=1S/C19H21N5OS/c1-13-9-18(21-17-11-15(26-2)3-4-16(13)17)24-7-5-23(6-8-24)14-10-19(25)22-20-12-14/h3-4,9-12H,5-8H2,1-2H3,(H,22,25) |
| InChIKey | IVACIDAJXYWSTR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |