C16H17ClFN3OS — CID 46994794
N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-(4-fluorophenoxy)-N-methylpropan-1-amine (PubChem CID 46994794) has the molecular formula C16H17ClFN3OS and a molecular weight of 353.85 g/mol. Its IUPAC name is N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-(4-fluorophenoxy)-N-methylpropan-1-amine.
| Compound Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-(4-fluorophenoxy)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 46994794 |
| Molecular Formula | C16H17ClFN3OS |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-3-(4-fluorophenoxy)-N-methylpropan-1-amine |
| SMILES | CN(CCCOc1ccc(F)cc1)Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C16H17ClFN3OS/c1-20(7-2-9-22-13-5-3-12(18)4-6-13)11-14-15(17)19-16-21(14)8-10-23-16/h3-6,8,10H,2,7,9,11H2,1H3 |
| InChIKey | BSWVNFRGBAXJIZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|