C17H19N5O3 — CID 46995129
2-(2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-4-methyl-2-phenylpyrazol-3-yl)acetamide (PubChem CID 46995129) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-(2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-4-methyl-2-phenylpyrazol-3-yl)acetamide.
| Compound Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-4-methyl-2-phenylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 46995129 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-(2,5-dioxoimidazolidin-1-yl)-N-(5-ethyl-4-methyl-2-phenylpyrazol-3-yl)acetamide |
| SMILES | CCc1nn(-c2ccccc2)c(NC(=O)CN2C(=O)CNC2=O)c1C |
| InChI | InChI=1S/C17H19N5O3/c1-3-13-11(2)16(22(20-13)12-7-5-4-6-8-12)19-14(23)10-21-15(24)9-18-17(21)25/h4-8H,3,9-10H2,1-2H3,(H,18,25)(H,19,23) |
| InChIKey | UFEXQNDPQBJXKU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|