C17H26N4S — CID 46996812
4-[4-(2-methylpropyl)triazol-1-yl]-1-[(3-methylthiophen-2-yl)methyl]piperidine (PubChem CID 46996812) has the molecular formula C17H26N4S and a molecular weight of 318.49 g/mol. Its IUPAC name is 4-[4-(2-methylpropyl)triazol-1-yl]-1-[(3-methylthiophen-2-yl)methyl]piperidine.
| Compound Name | 4-[4-(2-methylpropyl)triazol-1-yl]-1-[(3-methylthiophen-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 46996812 |
| Molecular Formula | C17H26N4S |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 4-[4-(2-methylpropyl)triazol-1-yl]-1-[(3-methylthiophen-2-yl)methyl]piperidine |
| SMILES | Cc1ccsc1CN1CCC(n2cc(CC(C)C)nn2)CC1 |
| InChI | InChI=1S/C17H26N4S/c1-13(2)10-15-11-21(19-18-15)16-4-7-20(8-5-16)12-17-14(3)6-9-22-17/h6,9,11,13,16H,4-5,7-8,10,12H2,1-3H3 |
| InChIKey | POBLFZYOZMFFCV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |