C19H16FN5O — CID 46997757
2-[5-(3-fluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide (PubChem CID 46997757) has the molecular formula C19H16FN5O and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[5-(3-fluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide.
| Compound Name | 2-[5-(3-fluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide |
|---|---|
| PubChem CID | 46997757 |
| Molecular Formula | C19H16FN5O |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[5-(3-fluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide |
| SMILES | Cn1ncc(NC(=O)Cn2ccc3cc(-c4cccc(F)c4)ccc32)n1 |
| InChI | InChI=1S/C19H16FN5O/c1-24-21-11-18(23-24)22-19(26)12-25-8-7-15-9-14(5-6-17(15)25)13-3-2-4-16(20)10-13/h2-11H,12H2,1H3,(H,22,23,26) |
| InChIKey | VASPNHRBNHNBDP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |