C19H15F2N5O — CID 46997061
2-[5-(2,3-difluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide (PubChem CID 46997061) has the molecular formula C19H15F2N5O and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-[5-(2,3-difluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide.
| Compound Name | 2-[5-(2,3-difluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide |
|---|---|
| PubChem CID | 46997061 |
| Molecular Formula | C19H15F2N5O |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 2-[5-(2,3-difluorophenyl)indol-1-yl]-N-(2-methyltriazol-4-yl)acetamide |
| SMILES | Cn1ncc(NC(=O)Cn2ccc3cc(-c4cccc(F)c4F)ccc32)n1 |
| InChI | InChI=1S/C19H15F2N5O/c1-25-22-10-17(24-25)23-18(27)11-26-8-7-13-9-12(5-6-16(13)26)14-3-2-4-15(20)19(14)21/h2-10H,11H2,1H3,(H,23,24,27) |
| InChIKey | OBFKTUDEHWMXGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |