C37H39N3O4S2 — CID 4699799
11-[4-oxo-5-[[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid (PubChem CID 4699799) has the molecular formula C37H39N3O4S2 and a molecular weight of 653.87 g/mol. Its IUPAC name is 11-[4-oxo-5-[[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid.
| Compound Name | 11-[4-oxo-5-[[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid |
|---|---|
| PubChem CID | 4699799 |
| Molecular Formula | C37H39N3O4S2 |
| Molecular Weight | 653.87 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | 11-[4-oxo-5-[[1-phenyl-3-(3-phenylmethoxyphenyl)pyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(OCc3ccccc3)c2)SC1=S |
| InChI | InChI=1S/C37H39N3O4S2/c41-34(42)22-13-5-3-1-2-4-6-14-23-39-36(43)33(46-37(39)45)25-30-26-40(31-19-11-8-12-20-31)38-35(30)29-18-15-21-32(24-29)44-27-28-16-9-7-10-17-28/h7-12,15-21,24-26H,1-6,13-14,22-23,27H2,(H,41,42) |
| InChIKey | UUTYWBFBHSVMRM-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.87 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|