C34H35N3O2S2 — CID 4700063
3-heptyl-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 4700063) has the molecular formula C34H35N3O2S2 and a molecular weight of 581.81 g/mol. Its IUPAC name is 3-heptyl-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-heptyl-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4700063 |
| Molecular Formula | C34H35N3O2S2 |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | 3-heptyl-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCCCCN1C(=O)C(=Cc2cn(-c3ccccc3)nc2-c2cccc(OCc3ccc(C)cc3)c2)SC1=S |
| InChI | InChI=1S/C34H35N3O2S2/c1-3-4-5-6-10-20-36-33(38)31(41-34(36)40)22-28-23-37(29-13-8-7-9-14-29)35-32(28)27-12-11-15-30(21-27)39-24-26-18-16-25(2)17-19-26/h7-9,11-19,21-23H,3-6,10,20,24H2,1-2H3 |
| InChIKey | POTYPANAGLSMNW-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|