C31H27N3O4S2 — CID 6192478
4-[(5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 6192478) has the molecular formula C31H27N3O4S2 and a molecular weight of 569.71 g/mol. Its IUPAC name is 4-[(5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 6192478 |
| Molecular Formula | C31H27N3O4S2 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 4-[(5Z)-5-[[3-[3-[(4-methylphenyl)methoxy]phenyl]-1-phenylpyrazol-4-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | Cc1ccc(COc2cccc(-c3nn(-c4ccccc4)cc3/C=C3\SC(=S)N(CCCC(=O)O)C3=O)c2)cc1 |
| InChI | InChI=1S/C31H27N3O4S2/c1-21-12-14-22(15-13-21)20-38-26-10-5-7-23(17-26)29-24(19-34(32-29)25-8-3-2-4-9-25)18-27-30(37)33(31(39)40-27)16-6-11-28(35)36/h2-5,7-10,12-15,17-19H,6,11,16,20H2,1H3,(H,35,36)/b27-18- |
| InChIKey | LEXUOWLQJWUEHZ-IMRQLAEWSA-N |
| XLogP | 6.49 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|