C11H11NO3S — CID 47000979
6-methoxynaphthalene-2-sulfonamide (PubChem CID 47000979) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 6-methoxynaphthalene-2-sulfonamide.
| Compound Name | 6-methoxynaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 47000979 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 6-methoxynaphthalene-2-sulfonamide |
| SMILES | COc1ccc2cc(S(N)(=O)=O)ccc2c1 |
| InChI | InChI=1S/C11H11NO3S/c1-15-10-4-2-9-7-11(16(12,13)14)5-3-8(9)6-10/h2-7H,1H3,(H2,12,13,14) |
| InChIKey | FMZMBZYDYWZGKA-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |